C9H13N2OY- — CID 59979656
4-but-3-enyl-3-methyl-1,4-dihydropyrimidin-2-one;yttrium (PubChem CID 59979656) has the molecular formula C9H13N2OY- and a molecular weight of 254.12 g/mol. Its IUPAC name is 4-but-3-enyl-3-methyl-1,4-dihydropyrimidin-2-one;yttrium.
| Compound Name | 4-but-3-enyl-3-methyl-1,4-dihydropyrimidin-2-one;yttrium |
|---|---|
| PubChem CID | 59979656 |
| Molecular Formula | C9H13N2OY- |
| Molecular Weight | 254.12 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 4-but-3-enyl-3-methyl-1,4-dihydropyrimidin-2-one;yttrium |
| SMILES | [H]/[C-]=C\CCC1C=CNC(=O)N1C.[Y] |
| InChI | InChI=1S/C9H13N2O.Y/c1-3-4-5-8-6-7-10-9(12)11(8)2;/h1,3,6-8H,4-5H2,2H3,(H,10,12);/q-1; |
| InChIKey | CSFHLKLPNWJODN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.12 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|