C9H15OS+ — CID 23535022
(2,2-dimethyl-5-oxocyclopent-3-en-1-yl)-dimethylsulfanium (PubChem CID 23535022) has the molecular formula C9H15OS+ and a molecular weight of 171.28 g/mol. Its IUPAC name is (2,2-dimethyl-5-oxocyclopent-3-en-1-yl)-dimethylsulfanium.
| Compound Name | (2,2-dimethyl-5-oxocyclopent-3-en-1-yl)-dimethylsulfanium |
|---|---|
| PubChem CID | 23535022 |
| Molecular Formula | C9H15OS+ |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | (2,2-dimethyl-5-oxocyclopent-3-en-1-yl)-dimethylsulfanium |
| SMILES | C[S+](C)C1C(=O)C=CC1(C)C |
| InChI | InChI=1S/C9H15OS/c1-9(2)6-5-7(10)8(9)11(3)4/h5-6,8H,1-4H3/q+1 |
| InChIKey | SHYUHPBTTSKJKW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|