C22H19N7O3 — CID 23536204
methyl 4-[3-[[4-[3-(2-oxoethyl)anilino]-1,3,5-triazin-2-yl]amino]-1H-pyrazol-5-yl]benzoate (PubChem CID 23536204) has the molecular formula C22H19N7O3 and a molecular weight of 429.44 g/mol. Its IUPAC name is methyl 4-[3-[[4-[3-(2-oxoethyl)anilino]-1,3,5-triazin-2-yl]amino]-1H-pyrazol-5-yl]benzoate.
| Compound Name | methyl 4-[3-[[4-[3-(2-oxoethyl)anilino]-1,3,5-triazin-2-yl]amino]-1H-pyrazol-5-yl]benzoate |
|---|---|
| PubChem CID | 23536204 |
| Molecular Formula | C22H19N7O3 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | methyl 4-[3-[[4-[3-(2-oxoethyl)anilino]-1,3,5-triazin-2-yl]amino]-1H-pyrazol-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cc(Nc3ncnc(Nc4cccc(CC=O)c4)n3)n[nH]2)cc1 |
| InChI | InChI=1S/C22H19N7O3/c1-32-20(31)16-7-5-15(6-8-16)18-12-19(29-28-18)26-22-24-13-23-21(27-22)25-17-4-2-3-14(11-17)9-10-30/h2-8,10-13H,9H2,1H3,(H3,23,24,25,26,27,28,29) |
| InChIKey | HYVQPVAPBANNIT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|