C17H19N7O3 — CID 23536218
methyl 4-[3-[[4-(3-hydroxypropylamino)-1,3,5-triazin-2-yl]amino]-1H-pyrazol-5-yl]benzoate (PubChem CID 23536218) has the molecular formula C17H19N7O3 and a molecular weight of 369.39 g/mol. Its IUPAC name is methyl 4-[3-[[4-(3-hydroxypropylamino)-1,3,5-triazin-2-yl]amino]-1H-pyrazol-5-yl]benzoate.
| Compound Name | methyl 4-[3-[[4-(3-hydroxypropylamino)-1,3,5-triazin-2-yl]amino]-1H-pyrazol-5-yl]benzoate |
|---|---|
| PubChem CID | 23536218 |
| Molecular Formula | C17H19N7O3 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | methyl 4-[3-[[4-(3-hydroxypropylamino)-1,3,5-triazin-2-yl]amino]-1H-pyrazol-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cc(Nc3ncnc(NCCCO)n3)n[nH]2)cc1 |
| InChI | InChI=1S/C17H19N7O3/c1-27-15(26)12-5-3-11(4-6-12)13-9-14(24-23-13)21-17-20-10-19-16(22-17)18-7-2-8-25/h3-6,9-10,25H,2,7-8H2,1H3,(H3,18,19,20,21,22,23,24) |
| InChIKey | UMXOLCLDELUUMS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 137.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|