C16H8Cl2F6O4S — CID 23539910
3-[3-(2,5-dichlorobenzoyl)phenyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 23539910) has the molecular formula C16H8Cl2F6O4S and a molecular weight of 481.20 g/mol. Its IUPAC name is 3-[3-(2,5-dichlorobenzoyl)phenyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-[3-(2,5-dichlorobenzoyl)phenyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 23539910 |
| Molecular Formula | C16H8Cl2F6O4S |
| Molecular Weight | 481.20 g/mol |
| Exact Mass | 479.94 |
| IUPAC Name | 3-[3-(2,5-dichlorobenzoyl)phenyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | O=C(c1cccc(C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)c1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H8Cl2F6O4S/c17-10-4-5-12(18)11(7-10)13(25)8-2-1-3-9(6-8)14(19,20)15(21,22)16(23,24)29(26,27)28/h1-7H,(H,26,27,28) |
| InChIKey | QYRTUMABPWJHMK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.20 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|