C18H18Cl2O4S — CID 87143319
[3-(2,5-dichlorobenzoyl)phenyl] 2,2-dimethylpropane-1-sulfonate (PubChem CID 87143319) has the molecular formula C18H18Cl2O4S and a molecular weight of 401.31 g/mol. Its IUPAC name is [3-(2,5-dichlorobenzoyl)phenyl] 2,2-dimethylpropane-1-sulfonate.
| Compound Name | [3-(2,5-dichlorobenzoyl)phenyl] 2,2-dimethylpropane-1-sulfonate |
|---|---|
| PubChem CID | 87143319 |
| Molecular Formula | C18H18Cl2O4S |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | [3-(2,5-dichlorobenzoyl)phenyl] 2,2-dimethylpropane-1-sulfonate |
| SMILES | CC(C)(C)CS(=O)(=O)Oc1cccc(C(=O)c2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C18H18Cl2O4S/c1-18(2,3)11-25(22,23)24-14-6-4-5-12(9-14)17(21)15-10-13(19)7-8-16(15)20/h4-10H,11H2,1-3H3 |
| InChIKey | CNYTUWLPJBREOX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|