About 2-methylpropyl 5-(2,5-dichlorobenzoyl)-2-[4-(2-methylpropoxysulfonyl)phenyl]benzenesulfonate
2-methylpropyl 5-(2,5-dichlorobenzoyl)-2-[4-(2-methylpropoxysulfonyl)phenyl]benzenesulfonate (PubChem CID 88568123) has the molecular formula C27H28Cl2O7S2
and a molecular weight of 599.55 g/mol. Its IUPAC name is 2-methylpropyl 5-(2,5-dichlorobenzoyl)-2-[4-(2-methylpropoxysulfonyl)phenyl]benzenesulfonate.
Molecular Properties
| Compound Name | 2-methylpropyl 5-(2,5-dichlorobenzoyl)-2-[4-(2-methylpropoxysulfonyl)phenyl]benzenesulfonate |
| PubChem CID | 88568123 |
| Molecular Formula | C27H28Cl2O7S2 |
| Molecular Weight | 599.55 g/mol |
| Exact Mass | 598.07 |
| IUPAC Name | 2-methylpropyl 5-(2,5-dichlorobenzoyl)-2-[4-(2-methylpropoxysulfonyl)phenyl]benzenesulfonate |
| SMILES | CC(C)COS(=O)(=O)c1ccc(-c2ccc(C(=O)c3cc(Cl)ccc3Cl)cc2S(=O)(=O)OCC(C)C)cc1 |
| InChI | InChI=1S/C27H28Cl2O7S2/c1-17(2)15-35-37(31,32)22-9-5-19(6-10-22)23-11-7-20(13-26(23)38(33,34)36-16-18(3)4)27(30)24-14-21(28)8-12-25(24)29/h5-14,17-18H,15-16H2,1-4H3 |
| InChIKey | OTVKRYBUGDVGQD-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 599.55 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl 5-(2,5-dichlorobenzoyl)-2-[4-(2-methylpropoxysulfonyl)phenyl]benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 5-(2,5-dichlorobenzoyl)-2-[4-(2-methylpropoxysulfonyl)phenyl]benzenesulfonate?
The IUPAC name of 2-methylpropyl 5-(2,5-dichlorobenzoyl)-2-[4-(2-methylpropoxysulfonyl)phenyl]benzenesulfonate (CID 88568123) is 2-methylpropyl 5-(2,5-dichlorobenzoyl)-2-[4-(2-methylpropoxysulfonyl)phenyl]benzenesulfonate.
What is the SMILES notation for 2-methylpropyl 5-(2,5-dichlorobenzoyl)-2-[4-(2-methylpropoxysulfonyl)phenyl]benzenesulfonate?
The canonical SMILES for 2-methylpropyl 5-(2,5-dichlorobenzoyl)-2-[4-(2-methylpropoxysulfonyl)phenyl]benzenesulfonate is CC(C)COS(=O)(=O)c1ccc(-c2ccc(C(=O)c3cc(Cl)ccc3Cl)cc2S(=O)(=O)OCC(C)C)cc1.
What is the InChIKey of 2-methylpropyl 5-(2,5-dichlorobenzoyl)-2-[4-(2-methylpropoxysulfonyl)phenyl]benzenesulfonate?
The InChIKey is OTVKRYBUGDVGQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28Cl2O7S2/c1-17(2)15-35-37(31,32)22-9-5-19(6-10-22)23-11-7-20(13-26(23)38(33,34)36-16-18(3)4)27(30)24-14-21(28)8-12-25(24)29/h5-14,17-18H,15-16H2,1-4H3.
What are the key properties of 2-methylpropyl 5-(2,5-dichlorobenzoyl)-2-[4-(2-methylpropoxysulfonyl)phenyl]benzenesulfonate?
2-methylpropyl 5-(2,5-dichlorobenzoyl)-2-[4-(2-methylpropoxysulfonyl)phenyl]benzenesulfonate has a molecular weight of 599.55 g/mol, XLogP of 6.61, 11 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 5-(2,5-dichlorobenzoyl)-2-[4-(2-methylpropoxysulfonyl)phenyl]benzenesulfonate is sourced from PubChem (CID 88568123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).