C25H24Cl2O11S3 — CID 89387092
diethyl 4-[4-(2,5-dichlorobenzoyl)-2-ethoxysulfonylphenoxy]benzene-1,3-disulfonate (PubChem CID 89387092) has the molecular formula C25H24Cl2O11S3 and a molecular weight of 667.56 g/mol. Its IUPAC name is diethyl 4-[4-(2,5-dichlorobenzoyl)-2-ethoxysulfonylphenoxy]benzene-1,3-disulfonate.
| Compound Name | diethyl 4-[4-(2,5-dichlorobenzoyl)-2-ethoxysulfonylphenoxy]benzene-1,3-disulfonate |
|---|---|
| PubChem CID | 89387092 |
| Molecular Formula | C25H24Cl2O11S3 |
| Molecular Weight | 667.56 g/mol |
| Exact Mass | 665.99 |
| IUPAC Name | diethyl 4-[4-(2,5-dichlorobenzoyl)-2-ethoxysulfonylphenoxy]benzene-1,3-disulfonate |
| SMILES | CCOS(=O)(=O)c1ccc(Oc2ccc(C(=O)c3cc(Cl)ccc3Cl)cc2S(=O)(=O)OCC)c(S(=O)(=O)OCC)c1 |
| InChI | InChI=1S/C25H24Cl2O11S3/c1-4-35-39(29,30)18-9-12-22(24(15-18)41(33,34)37-6-3)38-21-11-7-16(13-23(21)40(31,32)36-5-2)25(28)19-14-17(26)8-10-20(19)27/h7-15H,4-6H2,1-3H3 |
| InChIKey | FCMXUJMZHFGASS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 156.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|