C25H16Cl2O8S2 — CID 59330874
5-[4-(2,5-dichlorobenzoyl)phenoxy]-2-(4-sulfophenyl)benzenesulfonic acid (PubChem CID 59330874) has the molecular formula C25H16Cl2O8S2 and a molecular weight of 579.44 g/mol. Its IUPAC name is 5-[4-(2,5-dichlorobenzoyl)phenoxy]-2-(4-sulfophenyl)benzenesulfonic acid.
| Compound Name | 5-[4-(2,5-dichlorobenzoyl)phenoxy]-2-(4-sulfophenyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 59330874 |
| Molecular Formula | C25H16Cl2O8S2 |
| Molecular Weight | 579.44 g/mol |
| Exact Mass | 577.97 |
| IUPAC Name | 5-[4-(2,5-dichlorobenzoyl)phenoxy]-2-(4-sulfophenyl)benzenesulfonic acid |
| SMILES | O=C(c1ccc(Oc2ccc(-c3ccc(S(=O)(=O)O)cc3)c(S(=O)(=O)O)c2)cc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C25H16Cl2O8S2/c26-17-5-12-23(27)22(13-17)25(28)16-1-6-18(7-2-16)35-19-8-11-21(24(14-19)37(32,33)34)15-3-9-20(10-4-15)36(29,30)31/h1-14H,(H,29,30,31)(H,32,33,34) |
| InChIKey | CFNHJIPRBFGXJP-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 135.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.44 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|