C23H13Cl2F7O6S — CID 102497463
2,2,2-trifluoroethyl 2-[4-[4-(2,5-dichlorobenzoyl)phenoxy]phenoxy]-1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 102497463) has the molecular formula C23H13Cl2F7O6S and a molecular weight of 621.31 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[4-[4-(2,5-dichlorobenzoyl)phenoxy]phenoxy]-1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | 2,2,2-trifluoroethyl 2-[4-[4-(2,5-dichlorobenzoyl)phenoxy]phenoxy]-1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 102497463 |
| Molecular Formula | C23H13Cl2F7O6S |
| Molecular Weight | 621.31 g/mol |
| Exact Mass | 619.97 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[4-[4-(2,5-dichlorobenzoyl)phenoxy]phenoxy]-1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | O=C(c1ccc(Oc2ccc(OC(F)(F)C(F)(F)S(=O)(=O)OCC(F)(F)F)cc2)cc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C23H13Cl2F7O6S/c24-14-3-10-19(25)18(11-14)20(33)13-1-4-15(5-2-13)37-16-6-8-17(9-7-16)38-22(29,30)23(31,32)39(34,35)36-12-21(26,27)28/h1-11H,12H2 |
| InChIKey | XXJQCNQVQADYKH-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.31 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|