C23H14Cl2O5S — CID 89065480
8-[4-(2,5-dichlorobenzoyl)phenoxy]naphthalene-1-sulfonic acid (PubChem CID 89065480) has the molecular formula C23H14Cl2O5S and a molecular weight of 473.33 g/mol. Its IUPAC name is 8-[4-(2,5-dichlorobenzoyl)phenoxy]naphthalene-1-sulfonic acid.
| Compound Name | 8-[4-(2,5-dichlorobenzoyl)phenoxy]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 89065480 |
| Molecular Formula | C23H14Cl2O5S |
| Molecular Weight | 473.33 g/mol |
| Exact Mass | 471.99 |
| IUPAC Name | 8-[4-(2,5-dichlorobenzoyl)phenoxy]naphthalene-1-sulfonic acid |
| SMILES | O=C(c1ccc(Oc2cccc3cccc(S(=O)(=O)O)c23)cc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C23H14Cl2O5S/c24-16-9-12-19(25)18(13-16)23(26)15-7-10-17(11-8-15)30-20-5-1-3-14-4-2-6-21(22(14)20)31(27,28)29/h1-13H,(H,27,28,29) |
| InChIKey | DGOLPJIUTMPIHL-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.33 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|