C18H11N3O4S — CID 2354140
N-[2-(1,3-benzothiazol-2-yl)phenyl]-5-nitrofuran-2-carboxamide (PubChem CID 2354140) has the molecular formula C18H11N3O4S and a molecular weight of 365.37 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)phenyl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)phenyl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 2354140 |
| Molecular Formula | C18H11N3O4S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)phenyl]-5-nitrofuran-2-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1nc2ccccc2s1)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C18H11N3O4S/c22-17(14-9-10-16(25-14)21(23)24)19-12-6-2-1-5-11(12)18-20-13-7-3-4-8-15(13)26-18/h1-10H,(H,19,22) |
| InChIKey | FNRDMVQVWPUJRS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|