C13H14N4O3 — CID 23541585
4-amino-8-[5-(hydroxymethyl)-3-methylideneoxolan-2-yl]pyrido[2,3-d]pyrimidin-5-one (PubChem CID 23541585) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is 4-amino-8-[5-(hydroxymethyl)-3-methylideneoxolan-2-yl]pyrido[2,3-d]pyrimidin-5-one.
| Compound Name | 4-amino-8-[5-(hydroxymethyl)-3-methylideneoxolan-2-yl]pyrido[2,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 23541585 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 4-amino-8-[5-(hydroxymethyl)-3-methylideneoxolan-2-yl]pyrido[2,3-d]pyrimidin-5-one |
| SMILES | C=C1CC(CO)OC1n1ccc(=O)c2c(N)ncnc21 |
| InChI | InChI=1S/C13H14N4O3/c1-7-4-8(5-18)20-13(7)17-3-2-9(19)10-11(14)15-6-16-12(10)17/h2-3,6,8,13,18H,1,4-5H2,(H2,14,15,16) |
| InChIKey | IQTJXRYLPXTGJD-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|