C18H23N3O2S3 — CID 2354486
methyl N'-(1-benzylpiperidin-4-yl)-N-thiophen-2-ylsulfonylcarbamimidothioate (PubChem CID 2354486) has the molecular formula C18H23N3O2S3 and a molecular weight of 409.60 g/mol. Its IUPAC name is methyl N'-(1-benzylpiperidin-4-yl)-N-thiophen-2-ylsulfonylcarbamimidothioate.
| Compound Name | methyl N'-(1-benzylpiperidin-4-yl)-N-thiophen-2-ylsulfonylcarbamimidothioate |
|---|---|
| PubChem CID | 2354486 |
| Molecular Formula | C18H23N3O2S3 |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | methyl N'-(1-benzylpiperidin-4-yl)-N-thiophen-2-ylsulfonylcarbamimidothioate |
| SMILES | CS/C(=N\C1CCN(Cc2ccccc2)CC1)NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C18H23N3O2S3/c1-24-18(20-26(22,23)17-8-5-13-25-17)19-16-9-11-21(12-10-16)14-15-6-3-2-4-7-15/h2-8,13,16H,9-12,14H2,1H3,(H,19,20) |
| InChIKey | HZQCZNIMNAEQGJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|