C14H10ClF7N4O2S — CID 23545978
3,3,4,4,5,5,5-heptafluoropentan-2-yl 2-[4-(4-chloropyrazol-1-yl)pyrimidin-2-yl]sulfanylacetate (PubChem CID 23545978) has the molecular formula C14H10ClF7N4O2S and a molecular weight of 466.77 g/mol. Its IUPAC name is 3,3,4,4,5,5,5-heptafluoropentan-2-yl 2-[4-(4-chloropyrazol-1-yl)pyrimidin-2-yl]sulfanylacetate.
| Compound Name | 3,3,4,4,5,5,5-heptafluoropentan-2-yl 2-[4-(4-chloropyrazol-1-yl)pyrimidin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 23545978 |
| Molecular Formula | C14H10ClF7N4O2S |
| Molecular Weight | 466.77 g/mol |
| Exact Mass | 466.01 |
| IUPAC Name | 3,3,4,4,5,5,5-heptafluoropentan-2-yl 2-[4-(4-chloropyrazol-1-yl)pyrimidin-2-yl]sulfanylacetate |
| SMILES | CC(OC(=O)CSc1nccc(-n2cc(Cl)cn2)n1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H10ClF7N4O2S/c1-7(12(16,17)13(18,19)14(20,21)22)28-10(27)6-29-11-23-3-2-9(25-11)26-5-8(15)4-24-26/h2-5,7H,6H2,1H3 |
| InChIKey | HJJCWQSGSBZJAL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.77 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|