C13H8ClF7N4O2S — CID 23545981
2,2,3,3,4,4,4-heptafluorobutyl 2-[4-(4-chloropyrazol-1-yl)pyrimidin-2-yl]sulfanylacetate (PubChem CID 23545981) has the molecular formula C13H8ClF7N4O2S and a molecular weight of 452.74 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluorobutyl 2-[4-(4-chloropyrazol-1-yl)pyrimidin-2-yl]sulfanylacetate.
| Compound Name | 2,2,3,3,4,4,4-heptafluorobutyl 2-[4-(4-chloropyrazol-1-yl)pyrimidin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 23545981 |
| Molecular Formula | C13H8ClF7N4O2S |
| Molecular Weight | 452.74 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutyl 2-[4-(4-chloropyrazol-1-yl)pyrimidin-2-yl]sulfanylacetate |
| SMILES | O=C(CSc1nccc(-n2cc(Cl)cn2)n1)OCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H8ClF7N4O2S/c14-7-3-23-25(4-7)8-1-2-22-10(24-8)28-5-9(26)27-6-11(15,16)12(17,18)13(19,20)21/h1-4H,5-6H2 |
| InChIKey | IZLIKKBZSXIJMA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.74 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|