C14H12BrNO5S2 — CID 23546058
methyl 4-(4-bromophenyl)sulfinyl-3-sulfamoylbenzoate (PubChem CID 23546058) has the molecular formula C14H12BrNO5S2 and a molecular weight of 418.29 g/mol. Its IUPAC name is methyl 4-(4-bromophenyl)sulfinyl-3-sulfamoylbenzoate.
| Compound Name | methyl 4-(4-bromophenyl)sulfinyl-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 23546058 |
| Molecular Formula | C14H12BrNO5S2 |
| Molecular Weight | 418.29 g/mol |
| Exact Mass | 416.93 |
| IUPAC Name | methyl 4-(4-bromophenyl)sulfinyl-3-sulfamoylbenzoate |
| SMILES | COC(=O)c1ccc(S(=O)c2ccc(Br)cc2)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C14H12BrNO5S2/c1-21-14(17)9-2-7-12(13(8-9)23(16,19)20)22(18)11-5-3-10(15)4-6-11/h2-8H,1H3,(H2,16,19,20) |
| InChIKey | WLJLAJDPFBZEIC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |