C42H57N5O5S — CID 23558567
(2,6-ditert-butyl-4-methylcyclohexyl) 6-isocyano-2-[4-methoxy-3-[[2-methyl-5-(2-methylpentan-2-yl)phenoxy]sulfinylamino]phenyl]-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 23558567) has the molecular formula C42H57N5O5S and a molecular weight of 744.01 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methylcyclohexyl) 6-isocyano-2-[4-methoxy-3-[[2-methyl-5-(2-methylpentan-2-yl)phenoxy]sulfinylamino]phenyl]-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,6-ditert-butyl-4-methylcyclohexyl) 6-isocyano-2-[4-methoxy-3-[[2-methyl-5-(2-methylpentan-2-yl)phenoxy]sulfinylamino]phenyl]-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 23558567 |
| Molecular Formula | C42H57N5O5S |
| Molecular Weight | 744.01 g/mol |
| Exact Mass | 743.41 |
| IUPAC Name | (2,6-ditert-butyl-4-methylcyclohexyl) 6-isocyano-2-[4-methoxy-3-[[2-methyl-5-(2-methylpentan-2-yl)phenoxy]sulfinylamino]phenyl]-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1cn2[nH]c(-c3ccc(OC)c(NS(=O)Oc4cc(C(C)(C)CCC)ccc4C)c3)nc2c1C(=O)OC1C(C(C)(C)C)CC(C)CC1C(C)(C)C |
| InChI | InChI=1S/C42H57N5O5S/c1-14-19-42(10,11)28-17-15-26(3)34(23-28)52-53(49)46-31-22-27(16-18-33(31)50-13)37-44-38-35(32(43-12)24-47(38)45-37)39(48)51-36-29(40(4,5)6)20-25(2)21-30(36)41(7,8)9/h15-18,22-25,29-30,36,46H,14,19-21H2,1-11,13H3,(H,44,45) |
| InChIKey | OQSYEMAGVVJABJ-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 111.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.01 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|