C31H48N2O — CID 23562484
3-ethenoxy-2-N,4-N-bis(4-hexylphenyl)pentane-2,4-diamine (PubChem CID 23562484) has the molecular formula C31H48N2O and a molecular weight of 464.74 g/mol. Its IUPAC name is 3-ethenoxy-2-N,4-N-bis(4-hexylphenyl)pentane-2,4-diamine.
| Compound Name | 3-ethenoxy-2-N,4-N-bis(4-hexylphenyl)pentane-2,4-diamine |
|---|---|
| PubChem CID | 23562484 |
| Molecular Formula | C31H48N2O |
| Molecular Weight | 464.74 g/mol |
| Exact Mass | 464.38 |
| IUPAC Name | 3-ethenoxy-2-N,4-N-bis(4-hexylphenyl)pentane-2,4-diamine |
| SMILES | C=COC(C(C)Nc1ccc(CCCCCC)cc1)C(C)Nc1ccc(CCCCCC)cc1 |
| InChI | InChI=1S/C31H48N2O/c1-6-9-11-13-15-27-17-21-29(22-18-27)32-25(4)31(34-8-3)26(5)33-30-23-19-28(20-24-30)16-14-12-10-7-2/h8,17-26,31-33H,3,6-7,9-16H2,1-2,4-5H3 |
| InChIKey | ZPLHRCVTEUYHEP-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.74 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|