C19H29NO2 — CID 23562796
3-[(3R,4S)-3,4-dimethyl-1-(3-prop-2-enoxypropyl)piperidin-2-yl]phenol (PubChem CID 23562796) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 3-[(3R,4S)-3,4-dimethyl-1-(3-prop-2-enoxypropyl)piperidin-2-yl]phenol.
| Compound Name | 3-[(3R,4S)-3,4-dimethyl-1-(3-prop-2-enoxypropyl)piperidin-2-yl]phenol |
|---|---|
| PubChem CID | 23562796 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 3-[(3R,4S)-3,4-dimethyl-1-(3-prop-2-enoxypropyl)piperidin-2-yl]phenol |
| SMILES | C=CCOCCCN1CC[C@H](C)[C@@H](C)C1c1cccc(O)c1 |
| InChI | InChI=1S/C19H29NO2/c1-4-12-22-13-6-10-20-11-9-15(2)16(3)19(20)17-7-5-8-18(21)14-17/h4-5,7-8,14-16,19,21H,1,6,9-13H2,2-3H3/t15-,16+,19?/m0/s1 |
| InChIKey | JKEJJKGQEXRNSV-GWFKTICUSA-N |
| XLogP | 4.00 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|