About 3-[(3R,4R)-2,3-dimethyl-1-[2-(methylamino)ethyl]piperidin-4-yl]phenol
3-[(3R,4R)-2,3-dimethyl-1-[2-(methylamino)ethyl]piperidin-4-yl]phenol (PubChem CID 57268633) has the molecular formula C16H26N2O
and a molecular weight of 262.40 g/mol. Its IUPAC name is 3-[(3R,4R)-2,3-dimethyl-1-[2-(methylamino)ethyl]piperidin-4-yl]phenol.
Molecular Properties
| Compound Name | 3-[(3R,4R)-2,3-dimethyl-1-[2-(methylamino)ethyl]piperidin-4-yl]phenol |
| PubChem CID | 57268633 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 3-[(3R,4R)-2,3-dimethyl-1-[2-(methylamino)ethyl]piperidin-4-yl]phenol |
| SMILES | CNCCN1CC[C@@H](c2cccc(O)c2)[C@@H](C)C1C |
| InChI | InChI=1S/C16H26N2O/c1-12-13(2)18(10-8-17-3)9-7-16(12)14-5-4-6-15(19)11-14/h4-6,11-13,16-17,19H,7-10H2,1-3H3/t12-,13?,16+/m0/s1 |
| InChIKey | TUUSLHCGIOLZKU-GMRULEOSSA-N |
| XLogP | 2.43 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(3R,4R)-2,3-dimethyl-1-[2-(methylamino)ethyl]piperidin-4-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3R,4R)-2,3-dimethyl-1-[2-(methylamino)ethyl]piperidin-4-yl]phenol?
The IUPAC name of 3-[(3R,4R)-2,3-dimethyl-1-[2-(methylamino)ethyl]piperidin-4-yl]phenol (CID 57268633) is 3-[(3R,4R)-2,3-dimethyl-1-[2-(methylamino)ethyl]piperidin-4-yl]phenol.
What is the SMILES notation for 3-[(3R,4R)-2,3-dimethyl-1-[2-(methylamino)ethyl]piperidin-4-yl]phenol?
The canonical SMILES for 3-[(3R,4R)-2,3-dimethyl-1-[2-(methylamino)ethyl]piperidin-4-yl]phenol is CNCCN1CC[C@@H](c2cccc(O)c2)[C@@H](C)C1C.
What is the InChIKey of 3-[(3R,4R)-2,3-dimethyl-1-[2-(methylamino)ethyl]piperidin-4-yl]phenol?
The InChIKey is TUUSLHCGIOLZKU-GMRULEOSSA-N. The full InChI is InChI=1S/C16H26N2O/c1-12-13(2)18(10-8-17-3)9-7-16(12)14-5-4-6-15(19)11-14/h4-6,11-13,16-17,19H,7-10H2,1-3H3/t12-,13?,16+/m0/s1.
What are the key properties of 3-[(3R,4R)-2,3-dimethyl-1-[2-(methylamino)ethyl]piperidin-4-yl]phenol?
3-[(3R,4R)-2,3-dimethyl-1-[2-(methylamino)ethyl]piperidin-4-yl]phenol has a molecular weight of 262.40 g/mol, XLogP of 2.43, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3R,4R)-2,3-dimethyl-1-[2-(methylamino)ethyl]piperidin-4-yl]phenol is sourced from PubChem (CID 57268633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).