C15H27N2O8+ — CID 23563929
carboxymethyl-(1,4-dicarboxybutan-2-yl)-(3-formamido-2-hydroxypropyl)-propylazanium (PubChem CID 23563929) has the molecular formula C15H27N2O8+ and a molecular weight of 363.39 g/mol. Its IUPAC name is carboxymethyl-(1,4-dicarboxybutan-2-yl)-(3-formamido-2-hydroxypropyl)-propylazanium.
| Compound Name | carboxymethyl-(1,4-dicarboxybutan-2-yl)-(3-formamido-2-hydroxypropyl)-propylazanium |
|---|---|
| PubChem CID | 23563929 |
| Molecular Formula | C15H27N2O8+ |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | carboxymethyl-(1,4-dicarboxybutan-2-yl)-(3-formamido-2-hydroxypropyl)-propylazanium |
| SMILES | CCC[N+](CC(=O)O)(CC(O)CNC=O)C(CCC(=O)O)CC(=O)O |
| InChI | InChI=1S/C15H26N2O8/c1-2-5-17(9-15(24)25,8-12(19)7-16-10-18)11(6-14(22)23)3-4-13(20)21/h10-12,19H,2-9H2,1H3,(H3-,16,18,20,21,22,23,24,25)/p+1 |
| InChIKey | UFQNAWAUFVXODW-UHFFFAOYSA-O |
| XLogP | -0.89 |
| TPSA | 161.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|