About 4-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)heptan-4-yl prop-2-enoate
4-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)heptan-4-yl prop-2-enoate (PubChem CID 23569060) has the molecular formula C18H26O4
and a molecular weight of 306.40 g/mol. Its IUPAC name is 4-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)heptan-4-yl prop-2-enoate.
Molecular Properties
| Compound Name | 4-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)heptan-4-yl prop-2-enoate |
| PubChem CID | 23569060 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 4-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)heptan-4-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(CCC)(CCC)C1C2CC3OC(=O)C1C3C2 |
| InChI | InChI=1S/C18H26O4/c1-4-7-18(8-5-2,22-14(19)6-3)16-11-9-12-13(10-11)21-17(20)15(12)16/h6,11-13,15-16H,3-5,7-10H2,1-2H3 |
| InChIKey | YLLHAAXGKBOWJV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)heptan-4-yl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)heptan-4-yl prop-2-enoate?
The IUPAC name of 4-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)heptan-4-yl prop-2-enoate (CID 23569060) is 4-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)heptan-4-yl prop-2-enoate.
What is the SMILES notation for 4-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)heptan-4-yl prop-2-enoate?
The canonical SMILES for 4-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)heptan-4-yl prop-2-enoate is C=CC(=O)OC(CCC)(CCC)C1C2CC3OC(=O)C1C3C2.
What is the InChIKey of 4-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)heptan-4-yl prop-2-enoate?
The InChIKey is YLLHAAXGKBOWJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O4/c1-4-7-18(8-5-2,22-14(19)6-3)16-11-9-12-13(10-11)21-17(20)15(12)16/h6,11-13,15-16H,3-5,7-10H2,1-2H3.
What are the key properties of 4-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)heptan-4-yl prop-2-enoate?
4-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)heptan-4-yl prop-2-enoate has a molecular weight of 306.40 g/mol, XLogP of 3.25, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)heptan-4-yl prop-2-enoate is sourced from PubChem (CID 23569060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).