C25H36O4 — CID 23569071
[dicyclohexyl-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)methyl] 2-methylprop-2-enoate (PubChem CID 23569071) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is [dicyclohexyl-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)methyl] 2-methylprop-2-enoate.
| Compound Name | [dicyclohexyl-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)methyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 23569071 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | [dicyclohexyl-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)methyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C1CCCCC1)(C1CCCCC1)C1C2CC3OC(=O)C1C3C2 |
| InChI | InChI=1S/C25H36O4/c1-15(2)23(26)29-25(17-9-5-3-6-10-17,18-11-7-4-8-12-18)22-16-13-19-20(14-16)28-24(27)21(19)22/h16-22H,1,3-14H2,2H3 |
| InChIKey | BUIIPBDDPLARNT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|