C25H40O4 — CID 23569065
7-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)tridecan-7-yl 2-methylprop-2-enoate (PubChem CID 23569065) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is 7-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)tridecan-7-yl 2-methylprop-2-enoate.
| Compound Name | 7-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)tridecan-7-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 23569065 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | 7-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)tridecan-7-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCCCCC)(CCCCCC)C1C2CC3OC(=O)C1C3C2 |
| InChI | InChI=1S/C25H40O4/c1-5-7-9-11-13-25(14-12-10-8-6-2,29-23(26)17(3)4)22-18-15-19-20(16-18)28-24(27)21(19)22/h18-22H,3,5-16H2,1-2,4H3 |
| InChIKey | NBXBSPIXRQAQNT-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|