C15H15Cl3O6 — CID 23572117
(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)methyl 2-[(2,2,2-trichloroacetyl)oxymethyl]prop-2-enoate (PubChem CID 23572117) has the molecular formula C15H15Cl3O6 and a molecular weight of 397.64 g/mol. Its IUPAC name is (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)methyl 2-[(2,2,2-trichloroacetyl)oxymethyl]prop-2-enoate.
| Compound Name | (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)methyl 2-[(2,2,2-trichloroacetyl)oxymethyl]prop-2-enoate |
|---|---|
| PubChem CID | 23572117 |
| Molecular Formula | C15H15Cl3O6 |
| Molecular Weight | 397.64 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl)methyl 2-[(2,2,2-trichloroacetyl)oxymethyl]prop-2-enoate |
| SMILES | C=C(COC(=O)C(Cl)(Cl)Cl)C(=O)OCC1C2CC3OC(=O)C1C3C2 |
| InChI | InChI=1S/C15H15Cl3O6/c1-6(4-23-14(21)15(16,17)18)12(19)22-5-9-7-2-8-10(3-7)24-13(20)11(8)9/h7-11H,1-5H2 |
| InChIKey | NMOXFMGWHSBNNF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.64 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|