C48H54O2S4 — CID 23576559
2-[5-[2-hexa-1,3,5-triynoxy-5-hexoxy-4-[5-(3-hexyl-5-methylthiophen-2-yl)thiophen-2-yl]phenyl]thiophen-2-yl]-3-hexyl-5-methylthiophene (PubChem CID 23576559) has the molecular formula C48H54O2S4 and a molecular weight of 791.23 g/mol. Its IUPAC name is 2-[5-[2-hexa-1,3,5-triynoxy-5-hexoxy-4-[5-(3-hexyl-5-methylthiophen-2-yl)thiophen-2-yl]phenyl]thiophen-2-yl]-3-hexyl-5-methylthiophene.
| Compound Name | 2-[5-[2-hexa-1,3,5-triynoxy-5-hexoxy-4-[5-(3-hexyl-5-methylthiophen-2-yl)thiophen-2-yl]phenyl]thiophen-2-yl]-3-hexyl-5-methylthiophene |
|---|---|
| PubChem CID | 23576559 |
| Molecular Formula | C48H54O2S4 |
| Molecular Weight | 791.23 g/mol |
| Exact Mass | 790.30 |
| IUPAC Name | 2-[5-[2-hexa-1,3,5-triynoxy-5-hexoxy-4-[5-(3-hexyl-5-methylthiophen-2-yl)thiophen-2-yl]phenyl]thiophen-2-yl]-3-hexyl-5-methylthiophene |
| SMILES | C#CC#CC#COc1cc(-c2ccc(-c3sc(C)cc3CCCCCC)s2)c(OCCCCCC)cc1-c1ccc(-c2sc(C)cc2CCCCCC)s1 |
| InChI | InChI=1S/C48H54O2S4/c1-7-11-15-19-23-37-31-35(5)51-47(37)45-27-25-43(53-45)39-33-42(50-30-22-18-14-10-4)40(34-41(39)49-29-21-17-13-9-3)44-26-28-46(54-44)48-38(32-36(6)52-48)24-20-16-12-8-2/h3,25-28,31-34H,7-8,10-12,14-16,18-20,22-24,30H2,1-2,4-6H3 |
| InChIKey | PAHAWQHPPOTGBC-UHFFFAOYSA-N |
| XLogP | 15.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.23 |
| LogP ≤ 5 | 15.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|