C19H19Cl4N3O3 — CID 23577274
benzyl 3-hydroxy-4-[[(2,3,5,6-tetrachloro-4-pyridinyl)amino]methyl]piperidine-1-carboxylate (PubChem CID 23577274) has the molecular formula C19H19Cl4N3O3 and a molecular weight of 479.19 g/mol. Its IUPAC name is benzyl 3-hydroxy-4-[[(2,3,5,6-tetrachloro-4-pyridinyl)amino]methyl]piperidine-1-carboxylate.
| Compound Name | benzyl 3-hydroxy-4-[[(2,3,5,6-tetrachloro-4-pyridinyl)amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 23577274 |
| Molecular Formula | C19H19Cl4N3O3 |
| Molecular Weight | 479.19 g/mol |
| Exact Mass | 477.02 |
| IUPAC Name | benzyl 3-hydroxy-4-[[(2,3,5,6-tetrachloro-4-pyridinyl)amino]methyl]piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC(CNc2c(Cl)c(Cl)nc(Cl)c2Cl)C(O)C1 |
| InChI | InChI=1S/C19H19Cl4N3O3/c20-14-16(15(21)18(23)25-17(14)22)24-8-12-6-7-26(9-13(12)27)19(28)29-10-11-4-2-1-3-5-11/h1-5,12-13,27H,6-10H2,(H,24,25) |
| InChIKey | DJWFEEOFHKXWDG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.19 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|