C19H23FN2O3 — CID 23582105
1-(2-adamantyl)-3-(6-fluoro-4H-1,3-benzodioxin-8-yl)urea (PubChem CID 23582105) has the molecular formula C19H23FN2O3 and a molecular weight of 346.40 g/mol. Its IUPAC name is 1-(2-adamantyl)-3-(6-fluoro-4H-1,3-benzodioxin-8-yl)urea.
| Compound Name | 1-(2-adamantyl)-3-(6-fluoro-4H-1,3-benzodioxin-8-yl)urea |
|---|---|
| PubChem CID | 23582105 |
| Molecular Formula | C19H23FN2O3 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-(2-adamantyl)-3-(6-fluoro-4H-1,3-benzodioxin-8-yl)urea |
| SMILES | O=C(Nc1cc(F)cc2c1OCOC2)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C19H23FN2O3/c20-15-6-14-8-24-9-25-18(14)16(7-15)21-19(23)22-17-12-2-10-1-11(4-12)5-13(17)3-10/h6-7,10-13,17H,1-5,8-9H2,(H2,21,22,23) |
| InChIKey | PAGAKYJAWQYGKV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |