C15H17FN4O3 — CID 11537043
1-(6-fluoro-4H-1,3-benzodioxin-8-yl)-3-(3-imidazol-1-ylpropyl)urea (PubChem CID 11537043) has the molecular formula C15H17FN4O3 and a molecular weight of 320.32 g/mol. Its IUPAC name is 1-(6-fluoro-4H-1,3-benzodioxin-8-yl)-3-(3-imidazol-1-ylpropyl)urea.
| Compound Name | 1-(6-fluoro-4H-1,3-benzodioxin-8-yl)-3-(3-imidazol-1-ylpropyl)urea |
|---|---|
| PubChem CID | 11537043 |
| Molecular Formula | C15H17FN4O3 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-(6-fluoro-4H-1,3-benzodioxin-8-yl)-3-(3-imidazol-1-ylpropyl)urea |
| SMILES | O=C(NCCCn1ccnc1)Nc1cc(F)cc2c1OCOC2 |
| InChI | InChI=1S/C15H17FN4O3/c16-12-6-11-8-22-10-23-14(11)13(7-12)19-15(21)18-2-1-4-20-5-3-17-9-20/h3,5-7,9H,1-2,4,8,10H2,(H2,18,19,21) |
| InChIKey | OHWVVSURMJLLHT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|