C22H28F3NSi — CID 23584843
2,2-ditert-butyl-3-phenyl-1-[4-(trifluoromethyl)phenyl]azasiliridine (PubChem CID 23584843) has the molecular formula C22H28F3NSi and a molecular weight of 391.55 g/mol. Its IUPAC name is 2,2-ditert-butyl-3-phenyl-1-[4-(trifluoromethyl)phenyl]azasiliridine.
| Compound Name | 2,2-ditert-butyl-3-phenyl-1-[4-(trifluoromethyl)phenyl]azasiliridine |
|---|---|
| PubChem CID | 23584843 |
| Molecular Formula | C22H28F3NSi |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2,2-ditert-butyl-3-phenyl-1-[4-(trifluoromethyl)phenyl]azasiliridine |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)C(c2ccccc2)N1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H28F3NSi/c1-20(2,3)27(21(4,5)6)19(16-10-8-7-9-11-16)26(27)18-14-12-17(13-15-18)22(23,24)25/h7-15,19H,1-6H3 |
| InChIKey | XFVSIGDTIORTFR-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|