About (5S)-5-phenyl-1-[4-(trifluoromethyl)phenyl]-4,5-dihydrotriazole
(5S)-5-phenyl-1-[4-(trifluoromethyl)phenyl]-4,5-dihydrotriazole (PubChem CID 139205001) has the molecular formula C15H12F3N3
and a molecular weight of 291.28 g/mol. Its IUPAC name is (5S)-5-phenyl-1-[4-(trifluoromethyl)phenyl]-4,5-dihydrotriazole.
Molecular Properties
| Compound Name | (5S)-5-phenyl-1-[4-(trifluoromethyl)phenyl]-4,5-dihydrotriazole |
| PubChem CID | 139205001 |
| Molecular Formula | C15H12F3N3 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | (5S)-5-phenyl-1-[4-(trifluoromethyl)phenyl]-4,5-dihydrotriazole |
| SMILES | FC(F)(F)c1ccc(N2N=NC[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C15H12F3N3/c16-15(17,18)12-6-8-13(9-7-12)21-14(10-19-20-21)11-4-2-1-3-5-11/h1-9,14H,10H2/t14-/m1/s1 |
| InChIKey | HOGFRSZPQXLSTQ-CQSZACIVSA-N |
| XLogP | 4.63 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S)-5-phenyl-1-[4-(trifluoromethyl)phenyl]-4,5-dihydrotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-phenyl-1-[4-(trifluoromethyl)phenyl]-4,5-dihydrotriazole?
The IUPAC name of (5S)-5-phenyl-1-[4-(trifluoromethyl)phenyl]-4,5-dihydrotriazole (CID 139205001) is (5S)-5-phenyl-1-[4-(trifluoromethyl)phenyl]-4,5-dihydrotriazole.
What is the SMILES notation for (5S)-5-phenyl-1-[4-(trifluoromethyl)phenyl]-4,5-dihydrotriazole?
The canonical SMILES for (5S)-5-phenyl-1-[4-(trifluoromethyl)phenyl]-4,5-dihydrotriazole is FC(F)(F)c1ccc(N2N=NC[C@@H]2c2ccccc2)cc1.
What is the InChIKey of (5S)-5-phenyl-1-[4-(trifluoromethyl)phenyl]-4,5-dihydrotriazole?
The InChIKey is HOGFRSZPQXLSTQ-CQSZACIVSA-N. The full InChI is InChI=1S/C15H12F3N3/c16-15(17,18)12-6-8-13(9-7-12)21-14(10-19-20-21)11-4-2-1-3-5-11/h1-9,14H,10H2/t14-/m1/s1.
What are the key properties of (5S)-5-phenyl-1-[4-(trifluoromethyl)phenyl]-4,5-dihydrotriazole?
(5S)-5-phenyl-1-[4-(trifluoromethyl)phenyl]-4,5-dihydrotriazole has a molecular weight of 291.28 g/mol, XLogP of 4.63, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-phenyl-1-[4-(trifluoromethyl)phenyl]-4,5-dihydrotriazole is sourced from PubChem (CID 139205001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).