C21H35AlN4O5 — CID 23585958
CID 23585958 (PubChem CID 23585958) has the molecular formula C21H35AlN4O5 and a molecular weight of 450.52 g/mol.
| Compound Name | CID 23585958 |
|---|---|
| PubChem CID | 23585958 |
| Molecular Formula | C21H35AlN4O5 |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | — |
| SMILES | CC(=O)N[C@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)N[C@H]([Al])CCCCN.O.O |
| InChI | InChI=1S/C21H31N4O3.Al.2H2O/c1-16(26)24-18(15-17-9-4-2-5-10-17)21(28)25-14-8-11-19(25)20(27)23-13-7-3-6-12-22;;;/h2,4-5,9-10,13,18-19H,3,6-8,11-12,14-15,22H2,1H3,(H,23,27)(H,24,26);;2*1H2/t18-,19+;;;/m1.../s1 |
| InChIKey | BLFJYLOPCUVPBX-HYEHIYQISA-N |
| XLogP | -1.18 |
| TPSA | 167.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|