C22H31NO5 — CID 23586858
methyl 2-[4-[2-oxo-6-(3-oxo-4-phenylbutyl)piperidin-1-yl]butoxy]acetate (PubChem CID 23586858) has the molecular formula C22H31NO5 and a molecular weight of 389.49 g/mol. Its IUPAC name is methyl 2-[4-[2-oxo-6-(3-oxo-4-phenylbutyl)piperidin-1-yl]butoxy]acetate.
| Compound Name | methyl 2-[4-[2-oxo-6-(3-oxo-4-phenylbutyl)piperidin-1-yl]butoxy]acetate |
|---|---|
| PubChem CID | 23586858 |
| Molecular Formula | C22H31NO5 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | methyl 2-[4-[2-oxo-6-(3-oxo-4-phenylbutyl)piperidin-1-yl]butoxy]acetate |
| SMILES | COC(=O)COCCCCN1C(=O)CCCC1CCC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C22H31NO5/c1-27-22(26)17-28-15-6-5-14-23-19(10-7-11-21(23)25)12-13-20(24)16-18-8-3-2-4-9-18/h2-4,8-9,19H,5-7,10-17H2,1H3 |
| InChIKey | WIHHWVHGRTTZLC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|