C27H33FN2O3 — CID 23590709
benzyl N-[2-[3-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]cyclohexyl]carbamate (PubChem CID 23590709) has the molecular formula C27H33FN2O3 and a molecular weight of 452.57 g/mol. Its IUPAC name is benzyl N-[2-[3-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]cyclohexyl]carbamate.
| Compound Name | benzyl N-[2-[3-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 23590709 |
| Molecular Formula | C27H33FN2O3 |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | benzyl N-[2-[3-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]cyclohexyl]carbamate |
| SMILES | O=C(NC1CCCCC1C(=O)N1CCCC(Cc2ccc(F)cc2)C1)OCc1ccccc1 |
| InChI | InChI=1S/C27H33FN2O3/c28-23-14-12-20(13-15-23)17-22-9-6-16-30(18-22)26(31)24-10-4-5-11-25(24)29-27(32)33-19-21-7-2-1-3-8-21/h1-3,7-8,12-15,22,24-25H,4-6,9-11,16-19H2,(H,29,32) |
| InChIKey | GJGPEFYCEBUYFP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |