C19H23F9O — CID 23591031
1,1,1,6,7,7-hexafluoro-4-[(E)-3-spiro[3.4]octan-2-ylprop-2-enyl]-2-(trifluoromethyl)hept-6-en-2-ol (PubChem CID 23591031) has the molecular formula C19H23F9O and a molecular weight of 438.37 g/mol. Its IUPAC name is 1,1,1,6,7,7-hexafluoro-4-[(E)-3-spiro[3.4]octan-2-ylprop-2-enyl]-2-(trifluoromethyl)hept-6-en-2-ol.
| Compound Name | 1,1,1,6,7,7-hexafluoro-4-[(E)-3-spiro[3.4]octan-2-ylprop-2-enyl]-2-(trifluoromethyl)hept-6-en-2-ol |
|---|---|
| PubChem CID | 23591031 |
| Molecular Formula | C19H23F9O |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 1,1,1,6,7,7-hexafluoro-4-[(E)-3-spiro[3.4]octan-2-ylprop-2-enyl]-2-(trifluoromethyl)hept-6-en-2-ol |
| SMILES | OC(CC(C/C=C/C1CC2(CCCC2)C1)CC(F)=C(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H23F9O/c20-14(15(21)22)8-12(11-17(29,18(23,24)25)19(26,27)28)4-3-5-13-9-16(10-13)6-1-2-7-16/h3,5,12-13,29H,1-2,4,6-11H2/b5-3+ |
| InChIKey | ZKRGSYICGKTRBR-HWKANZROSA-N |
| XLogP | 7.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|