C18H21F9O — CID 23591027
1,1,1,5,6,6-hexafluoro-3-[(E)-3-spiro[3.4]octan-2-ylprop-2-enyl]-2-(trifluoromethyl)hex-5-en-2-ol (PubChem CID 23591027) has the molecular formula C18H21F9O and a molecular weight of 424.35 g/mol. Its IUPAC name is 1,1,1,5,6,6-hexafluoro-3-[(E)-3-spiro[3.4]octan-2-ylprop-2-enyl]-2-(trifluoromethyl)hex-5-en-2-ol.
| Compound Name | 1,1,1,5,6,6-hexafluoro-3-[(E)-3-spiro[3.4]octan-2-ylprop-2-enyl]-2-(trifluoromethyl)hex-5-en-2-ol |
|---|---|
| PubChem CID | 23591027 |
| Molecular Formula | C18H21F9O |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 1,1,1,5,6,6-hexafluoro-3-[(E)-3-spiro[3.4]octan-2-ylprop-2-enyl]-2-(trifluoromethyl)hex-5-en-2-ol |
| SMILES | OC(C(C/C=C/C1CC2(CCCC2)C1)CC(F)=C(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H21F9O/c19-13(14(20)21)8-12(16(28,17(22,23)24)18(25,26)27)5-3-4-11-9-15(10-11)6-1-2-7-15/h3-4,11-12,28H,1-2,5-10H2/b4-3+ |
| InChIKey | XUXCVFVEINVUSQ-ONEGZZNKSA-N |
| XLogP | 6.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|