C18H19F11O — CID 23591019
1,1,1,4,4,5,6,6-octafluoro-3-[(E)-3-spiro[3.4]octan-2-ylprop-2-enyl]-2-(trifluoromethyl)hex-5-en-2-ol (PubChem CID 23591019) has the molecular formula C18H19F11O and a molecular weight of 460.33 g/mol. Its IUPAC name is 1,1,1,4,4,5,6,6-octafluoro-3-[(E)-3-spiro[3.4]octan-2-ylprop-2-enyl]-2-(trifluoromethyl)hex-5-en-2-ol.
| Compound Name | 1,1,1,4,4,5,6,6-octafluoro-3-[(E)-3-spiro[3.4]octan-2-ylprop-2-enyl]-2-(trifluoromethyl)hex-5-en-2-ol |
|---|---|
| PubChem CID | 23591019 |
| Molecular Formula | C18H19F11O |
| Molecular Weight | 460.33 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 1,1,1,4,4,5,6,6-octafluoro-3-[(E)-3-spiro[3.4]octan-2-ylprop-2-enyl]-2-(trifluoromethyl)hex-5-en-2-ol |
| SMILES | OC(C(C/C=C/C1CC2(CCCC2)C1)C(F)(F)C(F)=C(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H19F11O/c19-12(13(20)21)15(22,23)11(16(30,17(24,25)26)18(27,28)29)5-3-4-10-8-14(9-10)6-1-2-7-14/h3-4,10-11,30H,1-2,5-9H2/b4-3+ |
| InChIKey | UEWHUWONWHDMTG-ONEGZZNKSA-N |
| XLogP | 7.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.33 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|