C16H20F6O — CID 23591039
(6E)-1,1,2-trifluoro-7-spiro[3.4]octan-2-yl-4-(trifluoromethyl)hepta-1,6-dien-4-ol (PubChem CID 23591039) has the molecular formula C16H20F6O and a molecular weight of 342.32 g/mol. Its IUPAC name is (6E)-1,1,2-trifluoro-7-spiro[3.4]octan-2-yl-4-(trifluoromethyl)hepta-1,6-dien-4-ol.
| Compound Name | (6E)-1,1,2-trifluoro-7-spiro[3.4]octan-2-yl-4-(trifluoromethyl)hepta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 23591039 |
| Molecular Formula | C16H20F6O |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (6E)-1,1,2-trifluoro-7-spiro[3.4]octan-2-yl-4-(trifluoromethyl)hepta-1,6-dien-4-ol |
| SMILES | OC(C/C=C/C1CC2(CCCC2)C1)(CC(F)=C(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H20F6O/c17-12(13(18)19)10-15(23,16(20,21)22)7-3-4-11-8-14(9-11)5-1-2-6-14/h3-4,11,23H,1-2,5-10H2/b4-3+ |
| InChIKey | FCRJSODGWBYIMS-ONEGZZNKSA-N |
| XLogP | 5.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|