About 5-[2,6-di(propan-2-yl)anilino]-4-isocyano-1,2-thiazol-3-one
5-[2,6-di(propan-2-yl)anilino]-4-isocyano-1,2-thiazol-3-one (PubChem CID 23592668) has the molecular formula C16H19N3OS
and a molecular weight of 301.42 g/mol. Its IUPAC name is 5-[2,6-di(propan-2-yl)anilino]-4-isocyano-1,2-thiazol-3-one.
Molecular Properties
| Compound Name | 5-[2,6-di(propan-2-yl)anilino]-4-isocyano-1,2-thiazol-3-one |
| PubChem CID | 23592668 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 5-[2,6-di(propan-2-yl)anilino]-4-isocyano-1,2-thiazol-3-one |
| SMILES | [C-]#[N+]c1c(Nc2c(C(C)C)cccc2C(C)C)s[nH]c1=O |
| InChI | InChI=1S/C16H19N3OS/c1-9(2)11-7-6-8-12(10(3)4)13(11)18-16-14(17-5)15(20)19-21-16/h6-10,18H,1-4H3,(H,19,20) |
| InChIKey | DTVQUDGMMYOVNT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-[2,6-di(propan-2-yl)anilino]-4-isocyano-1,2-thiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2,6-di(propan-2-yl)anilino]-4-isocyano-1,2-thiazol-3-one?
The IUPAC name of 5-[2,6-di(propan-2-yl)anilino]-4-isocyano-1,2-thiazol-3-one (CID 23592668) is 5-[2,6-di(propan-2-yl)anilino]-4-isocyano-1,2-thiazol-3-one.
What is the SMILES notation for 5-[2,6-di(propan-2-yl)anilino]-4-isocyano-1,2-thiazol-3-one?
The canonical SMILES for 5-[2,6-di(propan-2-yl)anilino]-4-isocyano-1,2-thiazol-3-one is [C-]#[N+]c1c(Nc2c(C(C)C)cccc2C(C)C)s[nH]c1=O.
What is the InChIKey of 5-[2,6-di(propan-2-yl)anilino]-4-isocyano-1,2-thiazol-3-one?
The InChIKey is DTVQUDGMMYOVNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3OS/c1-9(2)11-7-6-8-12(10(3)4)13(11)18-16-14(17-5)15(20)19-21-16/h6-10,18H,1-4H3,(H,19,20).
What are the key properties of 5-[2,6-di(propan-2-yl)anilino]-4-isocyano-1,2-thiazol-3-one?
5-[2,6-di(propan-2-yl)anilino]-4-isocyano-1,2-thiazol-3-one has a molecular weight of 301.42 g/mol, XLogP of 4.98, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2,6-di(propan-2-yl)anilino]-4-isocyano-1,2-thiazol-3-one is sourced from PubChem (CID 23592668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).