C16H19N3OS — CID 23592668
5-[2,6-di(propan-2-yl)anilino]-4-isocyano-1,2-thiazol-3-one (PubChem CID 23592668) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is 5-[2,6-di(propan-2-yl)anilino]-4-isocyano-1,2-thiazol-3-one.
| Compound Name | 5-[2,6-di(propan-2-yl)anilino]-4-isocyano-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 23592668 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 5-[2,6-di(propan-2-yl)anilino]-4-isocyano-1,2-thiazol-3-one |
| SMILES | [C-]#[N+]c1c(Nc2c(C(C)C)cccc2C(C)C)s[nH]c1=O |
| InChI | InChI=1S/C16H19N3OS/c1-9(2)11-7-6-8-12(10(3)4)13(11)18-16-14(17-5)15(20)19-21-16/h6-10,18H,1-4H3,(H,19,20) |
| InChIKey | DTVQUDGMMYOVNT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|