C36H31N3O3S — CID 23595955
15-methyl-8-(morpholine-4-carbonyl)-N-(4-naphthalen-1-yl-1,3-thiazol-2-yl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 23595955) has the molecular formula C36H31N3O3S and a molecular weight of 585.73 g/mol. Its IUPAC name is 15-methyl-8-(morpholine-4-carbonyl)-N-(4-naphthalen-1-yl-1,3-thiazol-2-yl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | 15-methyl-8-(morpholine-4-carbonyl)-N-(4-naphthalen-1-yl-1,3-thiazol-2-yl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 23595955 |
| Molecular Formula | C36H31N3O3S |
| Molecular Weight | 585.73 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | 15-methyl-8-(morpholine-4-carbonyl)-N-(4-naphthalen-1-yl-1,3-thiazol-2-yl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | CC1(C(=O)Nc2nc(-c3cccc4ccccc34)cs2)CC2(C(=O)N3CCOCC3)c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C36H31N3O3S/c1-35(32(40)38-34-37-30(21-43-34)25-14-8-10-23-9-2-3-11-24(23)25)22-36(33(41)39-17-19-42-20-18-39)28-15-6-4-12-26(28)31(35)27-13-5-7-16-29(27)36/h2-16,21,31H,17-20,22H2,1H3,(H,37,38,40) |
| InChIKey | GWSUPRLQGJLERJ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.73 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |