C33H25N3O3S — CID 11599166
15-methyl-8-nitro-N-[4-(3-phenylphenyl)-1,3-thiazol-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 11599166) has the molecular formula C33H25N3O3S and a molecular weight of 543.65 g/mol. Its IUPAC name is 15-methyl-8-nitro-N-[4-(3-phenylphenyl)-1,3-thiazol-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | 15-methyl-8-nitro-N-[4-(3-phenylphenyl)-1,3-thiazol-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 11599166 |
| Molecular Formula | C33H25N3O3S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 15-methyl-8-nitro-N-[4-(3-phenylphenyl)-1,3-thiazol-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | CC1(C(=O)Nc2nc(-c3cccc(-c4ccccc4)c3)cs2)CC2([N+](=O)[O-])c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C33H25N3O3S/c1-32(20-33(36(38)39)26-16-7-5-14-24(26)29(32)25-15-6-8-17-27(25)33)30(37)35-31-34-28(19-40-31)23-13-9-12-22(18-23)21-10-3-2-4-11-21/h2-19,29H,20H2,1H3,(H,34,35,37) |
| InChIKey | UBLKHXLEPJACEX-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|