About (4-methylphenyl)-(3H-pyrrol-2-yl)diazene;tungsten
(4-methylphenyl)-(3H-pyrrol-2-yl)diazene;tungsten (PubChem CID 23597691) has the molecular formula C11H11N3W3
and a molecular weight of 736.75 g/mol. Its IUPAC name is (4-methylphenyl)-(3H-pyrrol-2-yl)diazene;tungsten.
Molecular Properties
| Compound Name | (4-methylphenyl)-(3H-pyrrol-2-yl)diazene;tungsten |
| PubChem CID | 23597691 |
| Molecular Formula | C11H11N3W3 |
| Molecular Weight | 736.75 g/mol |
| Exact Mass | 736.95 |
| IUPAC Name | (4-methylphenyl)-(3H-pyrrol-2-yl)diazene;tungsten |
| SMILES | Cc1ccc(/N=N/C2=NC=CC2)cc1.[W].[W].[W] |
| InChI | InChI=1S/C11H11N3.3W/c1-9-4-6-10(7-5-9)13-14-11-3-2-8-12-11;;;/h2,4-8H,3H2,1H3;;;/b14-13+;;; |
| InChIKey | CCMSMRLNRDOSQR-VPOCKCTCSA-N |
| XLogP | 3.39 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 736.75 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl)-(3H-pyrrol-2-yl)diazene;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl)-(3H-pyrrol-2-yl)diazene;tungsten?
The IUPAC name of (4-methylphenyl)-(3H-pyrrol-2-yl)diazene;tungsten (CID 23597691) is (4-methylphenyl)-(3H-pyrrol-2-yl)diazene;tungsten.
What is the SMILES notation for (4-methylphenyl)-(3H-pyrrol-2-yl)diazene;tungsten?
The canonical SMILES for (4-methylphenyl)-(3H-pyrrol-2-yl)diazene;tungsten is Cc1ccc(/N=N/C2=NC=CC2)cc1.[W].[W].[W].
What is the InChIKey of (4-methylphenyl)-(3H-pyrrol-2-yl)diazene;tungsten?
The InChIKey is CCMSMRLNRDOSQR-VPOCKCTCSA-N. The full InChI is InChI=1S/C11H11N3.3W/c1-9-4-6-10(7-5-9)13-14-11-3-2-8-12-11;;;/h2,4-8H,3H2,1H3;;;/b14-13+;;;.
What are the key properties of (4-methylphenyl)-(3H-pyrrol-2-yl)diazene;tungsten?
(4-methylphenyl)-(3H-pyrrol-2-yl)diazene;tungsten has a molecular weight of 736.75 g/mol, XLogP of 3.39, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl)-(3H-pyrrol-2-yl)diazene;tungsten is sourced from PubChem (CID 23597691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).