About (2-oxooxolan-3-yl) 10-hydroxydecanoate
(2-oxooxolan-3-yl) 10-hydroxydecanoate (PubChem CID 23597890) has the molecular formula C14H24O5
and a molecular weight of 272.34 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 10-hydroxydecanoate.
Molecular Properties
| Compound Name | (2-oxooxolan-3-yl) 10-hydroxydecanoate |
| PubChem CID | 23597890 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (2-oxooxolan-3-yl) 10-hydroxydecanoate |
| SMILES | O=C(CCCCCCCCCO)OC1CCOC1=O |
| InChI | InChI=1S/C14H24O5/c15-10-7-5-3-1-2-4-6-8-13(16)19-12-9-11-18-14(12)17/h12,15H,1-11H2 |
| InChIKey | PLSXUMBSRAPUIZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-oxooxolan-3-yl) 10-hydroxydecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxooxolan-3-yl) 10-hydroxydecanoate?
The IUPAC name of (2-oxooxolan-3-yl) 10-hydroxydecanoate (CID 23597890) is (2-oxooxolan-3-yl) 10-hydroxydecanoate.
What is the SMILES notation for (2-oxooxolan-3-yl) 10-hydroxydecanoate?
The canonical SMILES for (2-oxooxolan-3-yl) 10-hydroxydecanoate is O=C(CCCCCCCCCO)OC1CCOC1=O.
What is the InChIKey of (2-oxooxolan-3-yl) 10-hydroxydecanoate?
The InChIKey is PLSXUMBSRAPUIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O5/c15-10-7-5-3-1-2-4-6-8-13(16)19-12-9-11-18-14(12)17/h12,15H,1-11H2.
What are the key properties of (2-oxooxolan-3-yl) 10-hydroxydecanoate?
(2-oxooxolan-3-yl) 10-hydroxydecanoate has a molecular weight of 272.34 g/mol, XLogP of 1.96, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxooxolan-3-yl) 10-hydroxydecanoate is sourced from PubChem (CID 23597890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).