C21H34O8S — CID 23598306
[4,5-dihydroxy-2,6-bis(methoxymethyl)-2,3,4,5,6-pentamethyloxan-3-yl] 4-methylbenzenesulfonate (PubChem CID 23598306) has the molecular formula C21H34O8S and a molecular weight of 446.56 g/mol. Its IUPAC name is [4,5-dihydroxy-2,6-bis(methoxymethyl)-2,3,4,5,6-pentamethyloxan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [4,5-dihydroxy-2,6-bis(methoxymethyl)-2,3,4,5,6-pentamethyloxan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 23598306 |
| Molecular Formula | C21H34O8S |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | [4,5-dihydroxy-2,6-bis(methoxymethyl)-2,3,4,5,6-pentamethyloxan-3-yl] 4-methylbenzenesulfonate |
| SMILES | COCC1(C)OC(C)(COC)C(C)(OS(=O)(=O)c2ccc(C)cc2)C(C)(O)C1(C)O |
| InChI | InChI=1S/C21H34O8S/c1-15-9-11-16(12-10-15)30(24,25)29-21(6)18(3,14-27-8)28-17(2,13-26-7)19(4,22)20(21,5)23/h9-12,22-23H,13-14H2,1-8H3 |
| InChIKey | LHAXYYQYXYUBRP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|