C14H11ClN4OS — CID 23604373
1-(1,2,3-benzothiadiazol-5-yl)-3-[(4-chlorophenyl)methyl]urea (PubChem CID 23604373) has the molecular formula C14H11ClN4OS and a molecular weight of 318.79 g/mol. Its IUPAC name is 1-(1,2,3-benzothiadiazol-5-yl)-3-[(4-chlorophenyl)methyl]urea.
| Compound Name | 1-(1,2,3-benzothiadiazol-5-yl)-3-[(4-chlorophenyl)methyl]urea |
|---|---|
| PubChem CID | 23604373 |
| Molecular Formula | C14H11ClN4OS |
| Molecular Weight | 318.79 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 1-(1,2,3-benzothiadiazol-5-yl)-3-[(4-chlorophenyl)methyl]urea |
| SMILES | O=C(NCc1ccc(Cl)cc1)Nc1ccc2snnc2c1 |
| InChI | InChI=1S/C14H11ClN4OS/c15-10-3-1-9(2-4-10)8-16-14(20)17-11-5-6-13-12(7-11)18-19-21-13/h1-7H,8H2,(H2,16,17,20) |
| InChIKey | JEENOUTYLDASFY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.79 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |