C23H26N2O2S — CID 23604904
N-[2-phenyl-2-(N,2,6-trimethylanilino)ethyl]benzenesulfonamide (PubChem CID 23604904) has the molecular formula C23H26N2O2S and a molecular weight of 394.54 g/mol. Its IUPAC name is N-[2-phenyl-2-(N,2,6-trimethylanilino)ethyl]benzenesulfonamide.
| Compound Name | N-[2-phenyl-2-(N,2,6-trimethylanilino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 23604904 |
| Molecular Formula | C23H26N2O2S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | N-[2-phenyl-2-(N,2,6-trimethylanilino)ethyl]benzenesulfonamide |
| SMILES | Cc1cccc(C)c1N(C)C(CNS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H26N2O2S/c1-18-11-10-12-19(2)23(18)25(3)22(20-13-6-4-7-14-20)17-24-28(26,27)21-15-8-5-9-16-21/h4-16,22,24H,17H2,1-3H3 |
| InChIKey | YNMCHJZWDKMNJL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |