C20H24N8O3 — CID 23607031
1-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-2-imino-3-phenylimidazolidin-4-one (PubChem CID 23607031) has the molecular formula C20H24N8O3 and a molecular weight of 424.47 g/mol. Its IUPAC name is 1-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-2-imino-3-phenylimidazolidin-4-one.
| Compound Name | 1-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-2-imino-3-phenylimidazolidin-4-one |
|---|---|
| PubChem CID | 23607031 |
| Molecular Formula | C20H24N8O3 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 1-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-2-imino-3-phenylimidazolidin-4-one |
| SMILES | [H]/N=C1/N(c2nc(N3CCOCC3)nc(N3CCOCC3)n2)CC(=O)N1c1ccccc1 |
| InChI | InChI=1S/C20H24N8O3/c21-17-27(14-16(29)28(17)15-4-2-1-3-5-15)20-23-18(25-6-10-30-11-7-25)22-19(24-20)26-8-12-31-13-9-26/h1-5,21H,6-14H2/b21-17- |
| InChIKey | YOSDIQTUEOZQBL-FXBPSFAMSA-N |
| XLogP | 0.33 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|