C25H23F3N2O — CID 2361087
(2E)-2-(3-ethyl-1,1-dimethylbenzo[e]indol-2-ylidene)-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 2361087) has the molecular formula C25H23F3N2O and a molecular weight of 424.47 g/mol. Its IUPAC name is (2E)-2-(3-ethyl-1,1-dimethylbenzo[e]indol-2-ylidene)-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | (2E)-2-(3-ethyl-1,1-dimethylbenzo[e]indol-2-ylidene)-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 2361087 |
| Molecular Formula | C25H23F3N2O |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (2E)-2-(3-ethyl-1,1-dimethylbenzo[e]indol-2-ylidene)-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCN1/C(=C/C(=O)Nc2cccc(C(F)(F)F)c2)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C25H23F3N2O/c1-4-30-20-13-12-16-8-5-6-11-19(16)23(20)24(2,3)21(30)15-22(31)29-18-10-7-9-17(14-18)25(26,27)28/h5-15H,4H2,1-3H3,(H,29,31)/b21-15+ |
| InChIKey | UOWCBTCMLDULNZ-RCCKNPSSSA-N |
| XLogP | 6.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|