About 3-aminobenzoic acid;2-(2-methylpropylamino)ethanol;hydrochloride
3-aminobenzoic acid;2-(2-methylpropylamino)ethanol;hydrochloride (PubChem CID 23617057) has the molecular formula C13H23ClN2O3
and a molecular weight of 290.79 g/mol. Its IUPAC name is 3-aminobenzoic acid;2-(2-methylpropylamino)ethanol;hydrochloride.
Molecular Properties
| Compound Name | 3-aminobenzoic acid;2-(2-methylpropylamino)ethanol;hydrochloride |
| PubChem CID | 23617057 |
| Molecular Formula | C13H23ClN2O3 |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 3-aminobenzoic acid;2-(2-methylpropylamino)ethanol;hydrochloride |
| SMILES | CC(C)CNCCO.Cl.Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C7H7NO2.C6H15NO.ClH/c8-6-3-1-2-5(4-6)7(9)10;1-6(2)5-7-3-4-8;/h1-4H,8H2,(H,9,10);6-8H,3-5H2,1-2H3;1H |
| InChIKey | FFNIITUMYBOLAX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-aminobenzoic acid;2-(2-methylpropylamino)ethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminobenzoic acid;2-(2-methylpropylamino)ethanol;hydrochloride?
The IUPAC name of 3-aminobenzoic acid;2-(2-methylpropylamino)ethanol;hydrochloride (CID 23617057) is 3-aminobenzoic acid;2-(2-methylpropylamino)ethanol;hydrochloride.
What is the SMILES notation for 3-aminobenzoic acid;2-(2-methylpropylamino)ethanol;hydrochloride?
The canonical SMILES for 3-aminobenzoic acid;2-(2-methylpropylamino)ethanol;hydrochloride is CC(C)CNCCO.Cl.Nc1cccc(C(=O)O)c1.
What is the InChIKey of 3-aminobenzoic acid;2-(2-methylpropylamino)ethanol;hydrochloride?
The InChIKey is FFNIITUMYBOLAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C6H15NO.ClH/c8-6-3-1-2-5(4-6)7(9)10;1-6(2)5-7-3-4-8;/h1-4H,8H2,(H,9,10);6-8H,3-5H2,1-2H3;1H.
What are the key properties of 3-aminobenzoic acid;2-(2-methylpropylamino)ethanol;hydrochloride?
3-aminobenzoic acid;2-(2-methylpropylamino)ethanol;hydrochloride has a molecular weight of 290.79 g/mol, XLogP of 1.61, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminobenzoic acid;2-(2-methylpropylamino)ethanol;hydrochloride is sourced from PubChem (CID 23617057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).